About [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine
[5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine (PubChem CID 82016594) has the molecular formula C9H9FN4
and a molecular weight of 192.20 g/mol. Its IUPAC name is [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine |
| PubChem CID | 82016594 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine |
| SMILES | NCc1cc(F)ccc1-n1cnnc1 |
| InChI | InChI=1S/C9H9FN4/c10-8-1-2-9(7(3-8)4-11)14-5-12-13-6-14/h1-3,5-6H,4,11H2 |
| InChIKey | WEYCXYOMJGHJKK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine?
The IUPAC name of [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine (CID 82016594) is [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine.
What is the SMILES notation for [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine?
The canonical SMILES for [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine is NCc1cc(F)ccc1-n1cnnc1.
What is the InChIKey of [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine?
The InChIKey is WEYCXYOMJGHJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4/c10-8-1-2-9(7(3-8)4-11)14-5-12-13-6-14/h1-3,5-6H,4,11H2.
What are the key properties of [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine?
[5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine has a molecular weight of 192.20 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-fluoro-2-(1,2,4-triazol-4-yl)phenyl]methanamine is sourced from PubChem (CID 82016594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).