C19H44N4O10 — CID 82017482
N,N'-bis(3-aminopropyl)butane-1,4-diamine;2,3,4,5,6,7,8,9-octahydroxynonanoic acid (PubChem CID 82017482) has the molecular formula C19H44N4O10 and a molecular weight of 488.58 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)butane-1,4-diamine;2,3,4,5,6,7,8,9-octahydroxynonanoic acid.
| Compound Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;2,3,4,5,6,7,8,9-octahydroxynonanoic acid |
|---|---|
| PubChem CID | 82017482 |
| Molecular Formula | C19H44N4O10 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;2,3,4,5,6,7,8,9-octahydroxynonanoic acid |
| SMILES | NCCCNCCCCNCCCN.O=C(O)C(O)C(O)C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H26N4.C9H18O10/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;10-1-2(11)3(12)4(13)5(14)6(15)7(16)8(17)9(18)19/h13-14H,1-12H2;2-8,10-17H,1H2,(H,18,19) |
| InChIKey | JGLIIDHFEBBGHM-UHFFFAOYSA-N |
| XLogP | -5.77 |
| TPSA | 275.24 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | -5.77 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|