C20H21N3S2 — CID 82018044
3,4-dimethyl-6-(4-methylphenyl)-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carbothioamide (PubChem CID 82018044) has the molecular formula C20H21N3S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 3,4-dimethyl-6-(4-methylphenyl)-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carbothioamide.
| Compound Name | 3,4-dimethyl-6-(4-methylphenyl)-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 82018044 |
| Molecular Formula | C20H21N3S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3,4-dimethyl-6-(4-methylphenyl)-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carbothioamide |
| SMILES | CC1=C(C(=S)Nc2ccccc2)C(c2ccc(C)cc2)NC(=S)N1C |
| InChI | InChI=1S/C20H21N3S2/c1-13-9-11-15(12-10-13)18-17(14(2)23(3)20(25)22-18)19(24)21-16-7-5-4-6-8-16/h4-12,18H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | LERPQAHMXOBUFX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|