C25H23N5O2 — CID 82018385
6-(4-ethylphenyl)-4-methyl-7-phenyl-2-prop-2-enylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 82018385) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-4-methyl-7-phenyl-2-prop-2-enylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(4-ethylphenyl)-4-methyl-7-phenyl-2-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 82018385 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 6-(4-ethylphenyl)-4-methyl-7-phenyl-2-prop-2-enylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | C=CCn1c(=O)c2c(nc3n(-c4ccc(CC)cc4)c(-c4ccccc4)cn23)n(C)c1=O |
| InChI | InChI=1S/C25H23N5O2/c1-4-15-28-23(31)21-22(27(3)25(28)32)26-24-29(21)16-20(18-9-7-6-8-10-18)30(24)19-13-11-17(5-2)12-14-19/h4,6-14,16H,1,5,15H2,2-3H3 |
| InChIKey | RDHMEIOSENKWIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|