C24H22ClN5O3 — CID 82018389
6-(3-chlorophenyl)-2-(2-ethoxyethyl)-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 82018389) has the molecular formula C24H22ClN5O3 and a molecular weight of 463.93 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-2-(2-ethoxyethyl)-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(3-chlorophenyl)-2-(2-ethoxyethyl)-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 82018389 |
| Molecular Formula | C24H22ClN5O3 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 6-(3-chlorophenyl)-2-(2-ethoxyethyl)-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCOCCn1c(=O)c2c(nc3n(-c4cccc(Cl)c4)c(-c4ccccc4)cn23)n(C)c1=O |
| InChI | InChI=1S/C24H22ClN5O3/c1-3-33-13-12-28-22(31)20-21(27(2)24(28)32)26-23-29(20)15-19(16-8-5-4-6-9-16)30(23)18-11-7-10-17(25)14-18/h4-11,14-15H,3,12-13H2,1-2H3 |
| InChIKey | BNOWHRRZVQTSEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|