C23H23BrN6O3 — CID 82018720
8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 82018720) has the molecular formula C23H23BrN6O3 and a molecular weight of 511.38 g/mol. Its IUPAC name is 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 82018720 |
| Molecular Formula | C23H23BrN6O3 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 8-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C23H23BrN6O3/c1-14-6-5-7-15(10-14)13-30-19-20(28(2)23(32)29(3)21(19)31)26-22(30)27-25-12-16-11-17(24)8-9-18(16)33-4/h5-12H,13H2,1-4H3,(H,26,27)/b25-12+ |
| InChIKey | JNMDEFYHJOYFND-BRJLIKDPSA-N |
| XLogP | 3.01 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|