C9H12N6O2 — CID 82018756
3,9-dimethyl-1,2,3,4-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 82018756) has the molecular formula C9H12N6O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3,9-dimethyl-1,2,3,4-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 3,9-dimethyl-1,2,3,4-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 82018756 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3,9-dimethyl-1,2,3,4-tetrahydropurino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1Cn2c(nc3c2c(=O)[nH]c(=O)n3C)NN1 |
| InChI | InChI=1S/C9H12N6O2/c1-4-3-15-5-6(10-8(15)13-12-4)14(2)9(17)11-7(5)16/h4,12H,3H2,1-2H3,(H,10,13)(H,11,16,17) |
| InChIKey | WDGOTMHXGBFXJR-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |