About 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one
2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 82018859) has the molecular formula C9H7ClFNO3S
and a molecular weight of 263.68 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
| PubChem CID | 82018859 |
| Molecular Formula | C9H7ClFNO3S |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | O=C1CCS(=O)(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H7ClFNO3S/c10-7-5-6(1-2-8(7)11)12-9(13)3-4-16(12,14)15/h1-2,5H,3-4H2 |
| InChIKey | PYCPAYSSZPNGEL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one?
The IUPAC name of 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one (CID 82018859) is 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one.
What is the SMILES notation for 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one?
The canonical SMILES for 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one is O=C1CCS(=O)(=O)N1c1ccc(F)c(Cl)c1.
What is the InChIKey of 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one?
The InChIKey is PYCPAYSSZPNGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClFNO3S/c10-7-5-6(1-2-8(7)11)12-9(13)3-4-16(12,14)15/h1-2,5H,3-4H2.
What are the key properties of 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one?
2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one has a molecular weight of 263.68 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-fluorophenyl)-1,1-dioxo-1,2-thiazolidin-3-one is sourced from PubChem (CID 82018859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).