C11H13Cl2NO2 — CID 82020685
3-amino-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 82020685) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is 3-amino-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | 3-amino-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 82020685 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 3-amino-6,8-dichloro-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)Oc2c(Cl)cc(Cl)cc2C(O)C1N |
| InChI | InChI=1S/C11H13Cl2NO2/c1-11(2)10(14)8(15)6-3-5(12)4-7(13)9(6)16-11/h3-4,8,10,15H,14H2,1-2H3 |
| InChIKey | VKHHROUMPWNCDU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |