About 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol
3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol (PubChem CID 82020697) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 82020697 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)Oc2ccc(-c3ccccc3)cc2C(O)C1N |
| InChI | InChI=1S/C17H19NO2/c1-17(2)16(18)15(19)13-10-12(8-9-14(13)20-17)11-6-4-3-5-7-11/h3-10,15-16,19H,18H2,1-2H3 |
| InChIKey | RZELDMPVYLGNCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol (CID 82020697) is 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol is CC1(C)Oc2ccc(-c3ccccc3)cc2C(O)C1N.
What is the InChIKey of 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol?
The InChIKey is RZELDMPVYLGNCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-17(2)16(18)15(19)13-10-12(8-9-14(13)20-17)11-6-4-3-5-7-11/h3-10,15-16,19H,18H2,1-2H3.
What are the key properties of 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol?
3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol has a molecular weight of 269.34 g/mol, XLogP of 2.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-dimethyl-6-phenyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 82020697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).