About 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride
3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride (PubChem CID 82020702) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride |
| PubChem CID | 82020702 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride |
| SMILES | Cc1ccc2c(c1)OC1(CCCC1)C(N)C2O.Cl |
| InChI | InChI=1S/C14H19NO2.ClH/c1-9-4-5-10-11(8-9)17-14(6-2-3-7-14)13(15)12(10)16;/h4-5,8,12-13,16H,2-3,6-7,15H2,1H3;1H |
| InChIKey | ITFMUIJXPVZFKB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride?
The IUPAC name of 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride (CID 82020702) is 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride.
What is the SMILES notation for 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride?
The canonical SMILES for 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride is Cc1ccc2c(c1)OC1(CCCC1)C(N)C2O.Cl.
What is the InChIKey of 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride?
The InChIKey is ITFMUIJXPVZFKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2.ClH/c1-9-4-5-10-11(8-9)17-14(6-2-3-7-14)13(15)12(10)16;/h4-5,8,12-13,16H,2-3,6-7,15H2,1H3;1H.
What are the key properties of 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride?
3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride has a molecular weight of 269.77 g/mol, XLogP of 2.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol;hydrochloride is sourced from PubChem (CID 82020702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).