About 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol
3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 82020755) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
Molecular Properties
| Compound Name | 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| PubChem CID | 82020755 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | NC1C(O)c2cc(Cl)ccc2OC12CCCCC2 |
| InChI | InChI=1S/C14H18ClNO2/c15-9-4-5-11-10(8-9)12(17)13(16)14(18-11)6-2-1-3-7-14/h4-5,8,12-13,17H,1-3,6-7,16H2 |
| InChIKey | VFTNCVCERONJBH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The IUPAC name of 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (CID 82020755) is 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
What is the SMILES notation for 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The canonical SMILES for 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol is NC1C(O)c2cc(Cl)ccc2OC12CCCCC2.
What is the InChIKey of 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The InChIKey is VFTNCVCERONJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO2/c15-9-4-5-11-10(8-9)12(17)13(16)14(18-11)6-2-1-3-7-14/h4-5,8,12-13,17H,1-3,6-7,16H2.
What are the key properties of 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol has a molecular weight of 267.76 g/mol, XLogP of 2.80, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-chlorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol is sourced from PubChem (CID 82020755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).