About 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride
2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride (PubChem CID 82020778) has the molecular formula C17H26Cl2N2O2
and a molecular weight of 361.31 g/mol. Its IUPAC name is 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride |
| PubChem CID | 82020778 |
| Molecular Formula | C17H26Cl2N2O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride |
| SMILES | Cc1ccc2c(c1)C(=O)CC(C)(CCN1CCNCC1)O2.Cl.Cl |
| InChI | InChI=1S/C17H24N2O2.2ClH/c1-13-3-4-16-14(11-13)15(20)12-17(2,21-16)5-8-19-9-6-18-7-10-19;;/h3-4,11,18H,5-10,12H2,1-2H3;2*1H |
| InChIKey | HKVLACQZHOVYAZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride?
The IUPAC name of 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride (CID 82020778) is 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride.
What is the SMILES notation for 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride?
The canonical SMILES for 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride is Cc1ccc2c(c1)C(=O)CC(C)(CCN1CCNCC1)O2.Cl.Cl.
What is the InChIKey of 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride?
The InChIKey is HKVLACQZHOVYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2.2ClH/c1-13-3-4-16-14(11-13)15(20)12-17(2,21-16)5-8-19-9-6-18-7-10-19;;/h3-4,11,18H,5-10,12H2,1-2H3;2*1H.
What are the key properties of 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride?
2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride has a molecular weight of 361.31 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2-(2-piperazin-1-ylethyl)-3H-chromen-4-one;dihydrochloride is sourced from PubChem (CID 82020778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).