About 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride
2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride (PubChem CID 82021857) has the molecular formula C13H16ClN3S2
and a molecular weight of 313.88 g/mol. Its IUPAC name is 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride |
| PubChem CID | 82021857 |
| Molecular Formula | C13H16ClN3S2 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride |
| SMILES | Cl.c1ccc(-c2nnc(SC3CCNCC3)s2)cc1 |
| InChI | InChI=1S/C13H15N3S2.ClH/c1-2-4-10(5-3-1)12-15-16-13(18-12)17-11-6-8-14-9-7-11;/h1-5,11,14H,6-9H2;1H |
| InChIKey | OGTOKKDVHDXXER-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride?
The IUPAC name of 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride (CID 82021857) is 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride.
What is the SMILES notation for 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride?
The canonical SMILES for 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride is Cl.c1ccc(-c2nnc(SC3CCNCC3)s2)cc1.
What is the InChIKey of 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride?
The InChIKey is OGTOKKDVHDXXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S2.ClH/c1-2-4-10(5-3-1)12-15-16-13(18-12)17-11-6-8-14-9-7-11;/h1-5,11,14H,6-9H2;1H.
What are the key properties of 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride?
2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride has a molecular weight of 313.88 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-piperidin-4-ylsulfanyl-1,3,4-thiadiazole;hydrochloride is sourced from PubChem (CID 82021857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).