C16H18FN3O2 — CID 82022519
2-fluoro-N-[6-(1-hydroxybutan-2-ylamino)-3-pyridinyl]benzamide (PubChem CID 82022519) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-fluoro-N-[6-(1-hydroxybutan-2-ylamino)-3-pyridinyl]benzamide.
| Compound Name | 2-fluoro-N-[6-(1-hydroxybutan-2-ylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 82022519 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-fluoro-N-[6-(1-hydroxybutan-2-ylamino)-3-pyridinyl]benzamide |
| SMILES | CCC(CO)Nc1ccc(NC(=O)c2ccccc2F)cn1 |
| InChI | InChI=1S/C16H18FN3O2/c1-2-11(10-21)19-15-8-7-12(9-18-15)20-16(22)13-5-3-4-6-14(13)17/h3-9,11,21H,2,10H2,1H3,(H,18,19)(H,20,22) |
| InChIKey | RILUYNPMWUWQIT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |