About 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol
4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol (PubChem CID 82023579) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol |
| PubChem CID | 82023579 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol |
| SMILES | COc1cc(C(C2=NCCN2)N(C)C)ccc1O |
| InChI | InChI=1S/C13H19N3O2/c1-16(2)12(13-14-6-7-15-13)9-4-5-10(17)11(8-9)18-3/h4-5,8,12,17H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | PJORSCLXNGSSRS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol?
The IUPAC name of 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol (CID 82023579) is 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol.
What is the SMILES notation for 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol?
The canonical SMILES for 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol is COc1cc(C(C2=NCCN2)N(C)C)ccc1O.
What is the InChIKey of 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol?
The InChIKey is PJORSCLXNGSSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-16(2)12(13-14-6-7-15-13)9-4-5-10(17)11(8-9)18-3/h4-5,8,12,17H,6-7H2,1-3H3,(H,14,15).
What are the key properties of 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol?
4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol has a molecular weight of 249.31 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-dihydro-1H-imidazol-2-yl(dimethylamino)methyl]-2-methoxyphenol is sourced from PubChem (CID 82023579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).