C10H14FNO3S — CID 82023677
1-amino-3-(4-fluoro-3-methylphenyl)sulfonylpropan-2-ol (PubChem CID 82023677) has the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. Its IUPAC name is 1-amino-3-(4-fluoro-3-methylphenyl)sulfonylpropan-2-ol.
| Compound Name | 1-amino-3-(4-fluoro-3-methylphenyl)sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 82023677 |
| Molecular Formula | C10H14FNO3S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 1-amino-3-(4-fluoro-3-methylphenyl)sulfonylpropan-2-ol |
| SMILES | Cc1cc(S(=O)(=O)CC(O)CN)ccc1F |
| InChI | InChI=1S/C10H14FNO3S/c1-7-4-9(2-3-10(7)11)16(14,15)6-8(13)5-12/h2-4,8,13H,5-6,12H2,1H3 |
| InChIKey | BLBAOHKBVIMHQR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |