C14H19N3 — CID 82024893
1-(5,6-dimethyl-1-prop-2-enylbenzimidazol-2-yl)ethanamine (PubChem CID 82024893) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1-prop-2-enylbenzimidazol-2-yl)ethanamine.
| Compound Name | 1-(5,6-dimethyl-1-prop-2-enylbenzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 82024893 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-(5,6-dimethyl-1-prop-2-enylbenzimidazol-2-yl)ethanamine |
| SMILES | C=CCn1c(C(C)N)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C14H19N3/c1-5-6-17-13-8-10(3)9(2)7-12(13)16-14(17)11(4)15/h5,7-8,11H,1,6,15H2,2-4H3 |
| InChIKey | OREZZPTYLWGAFR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|