C15H14N2O — CID 82027429
1-(furan-2-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 82027429) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-(furan-2-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 1-(furan-2-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 82027429 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(furan-2-yl)-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | c1coc(C2NCCn3c2cc2ccccc23)c1 |
| InChI | InChI=1S/C15H14N2O/c1-2-5-12-11(4-1)10-13-15(14-6-3-9-18-14)16-7-8-17(12)13/h1-6,9-10,15-16H,7-8H2 |
| InChIKey | RXMZQHDQMWSTNY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |