About 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline
5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline (PubChem CID 82027795) has the molecular formula C22H37N3
and a molecular weight of 343.56 g/mol. Its IUPAC name is 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline.
Molecular Properties
| Compound Name | 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline |
| PubChem CID | 82027795 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline |
| SMILES | CC1CCN(c2ccc(CCCN3CC(C)CC(C)C3)cc2N)CC1 |
| InChI | InChI=1S/C22H37N3/c1-17-8-11-25(12-9-17)22-7-6-20(14-21(22)23)5-4-10-24-15-18(2)13-19(3)16-24/h6-7,14,17-19H,4-5,8-13,15-16,23H2,1-3H3 |
| InChIKey | IIMPEEOIKUFQIW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline?
The IUPAC name of 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline (CID 82027795) is 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline.
What is the SMILES notation for 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline?
The canonical SMILES for 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline is CC1CCN(c2ccc(CCCN3CC(C)CC(C)C3)cc2N)CC1.
What is the InChIKey of 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline?
The InChIKey is IIMPEEOIKUFQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37N3/c1-17-8-11-25(12-9-17)22-7-6-20(14-21(22)23)5-4-10-24-15-18(2)13-19(3)16-24/h6-7,14,17-19H,4-5,8-13,15-16,23H2,1-3H3.
What are the key properties of 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline?
5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline has a molecular weight of 343.56 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-dimethylpiperidin-1-yl)propyl]-2-(4-methylpiperidin-1-yl)aniline is sourced from PubChem (CID 82027795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).