C12H15BrN2S2 — CID 82027844
4-(3-bromopropylsulfanyl)-2,5,6-trimethylthieno[2,3-d]pyrimidine (PubChem CID 82027844) has the molecular formula C12H15BrN2S2 and a molecular weight of 331.30 g/mol. Its IUPAC name is 4-(3-bromopropylsulfanyl)-2,5,6-trimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-(3-bromopropylsulfanyl)-2,5,6-trimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 82027844 |
| Molecular Formula | C12H15BrN2S2 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 4-(3-bromopropylsulfanyl)-2,5,6-trimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1nc(SCCCBr)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C12H15BrN2S2/c1-7-8(2)17-12-10(7)11(14-9(3)15-12)16-6-4-5-13/h4-6H2,1-3H3 |
| InChIKey | HLFKKISAKMAUHP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|