C21H26N4 — CID 82028938
3-[6-methyl-3-[(2-methylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline (PubChem CID 82028938) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 3-[6-methyl-3-[(2-methylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline.
| Compound Name | 3-[6-methyl-3-[(2-methylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
|---|---|
| PubChem CID | 82028938 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 3-[6-methyl-3-[(2-methylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridin-2-yl]aniline |
| SMILES | Cc1ccc2nc(-c3cccc(N)c3)c(CN3CCCCC3C)n2c1 |
| InChI | InChI=1S/C21H26N4/c1-15-9-10-20-23-21(17-7-5-8-18(22)12-17)19(25(20)13-15)14-24-11-4-3-6-16(24)2/h5,7-10,12-13,16H,3-4,6,11,14,22H2,1-2H3 |
| InChIKey | KNEOVQYIGHHMDO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|