About 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine
1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine (PubChem CID 82029054) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine.
Molecular Properties
| Compound Name | 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine |
| PubChem CID | 82029054 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine |
| SMILES | COCC(N)c1cnc2ccccn12 |
| InChI | InChI=1S/C10H13N3O/c1-14-7-8(11)9-6-12-10-4-2-3-5-13(9)10/h2-6,8H,7,11H2,1H3 |
| InChIKey | XBZCFEGXUFZYKI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine?
The IUPAC name of 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine (CID 82029054) is 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine.
What is the SMILES notation for 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine?
The canonical SMILES for 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine is COCC(N)c1cnc2ccccn12.
What is the InChIKey of 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine?
The InChIKey is XBZCFEGXUFZYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-14-7-8(11)9-6-12-10-4-2-3-5-13(9)10/h2-6,8H,7,11H2,1H3.
What are the key properties of 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine?
1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine has a molecular weight of 191.23 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[1,2-a]pyridin-3-yl-2-methoxyethanamine is sourced from PubChem (CID 82029054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).