C16H16N2O — CID 82029435
1-(8-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)ethanol (PubChem CID 82029435) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 1-(8-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)ethanol.
| Compound Name | 1-(8-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)ethanol |
|---|---|
| PubChem CID | 82029435 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(8-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)ethanol |
| SMILES | Cc1cccn2c(C(C)O)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C16H16N2O/c1-11-7-6-10-18-15(12(2)19)14(17-16(11)18)13-8-4-3-5-9-13/h3-10,12,19H,1-2H3 |
| InChIKey | MFYVHLRKEYFONK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |