C15H21N3O5 — CID 82031085
5-amino-5-oxo-2-[2-(2-oxo-1-pyridinyl)pentanoylamino]pentanoic acid (PubChem CID 82031085) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-amino-5-oxo-2-[2-(2-oxo-1-pyridinyl)pentanoylamino]pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-[2-(2-oxo-1-pyridinyl)pentanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 82031085 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 5-amino-5-oxo-2-[2-(2-oxo-1-pyridinyl)pentanoylamino]pentanoic acid |
| SMILES | CCCC(C(=O)NC(CCC(N)=O)C(=O)O)n1ccccc1=O |
| InChI | InChI=1S/C15H21N3O5/c1-2-5-11(18-9-4-3-6-13(18)20)14(21)17-10(15(22)23)7-8-12(16)19/h3-4,6,9-11H,2,5,7-8H2,1H3,(H2,16,19)(H,17,21)(H,22,23) |
| InChIKey | MDDSICWBNCMLQF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |