About 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid
4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid (PubChem CID 82033149) has the molecular formula C15H20N4O3S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid |
| PubChem CID | 82033149 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid |
| SMILES | CCC(Nc1ncnc2sc(C)cc12)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H20N4O3S/c1-3-11(14(22)16-6-4-5-12(20)21)19-13-10-7-9(2)23-15(10)18-8-17-13/h7-8,11H,3-6H2,1-2H3,(H,16,22)(H,20,21)(H,17,18,19) |
| InChIKey | MGMKSBZOTOGZAQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid?
The IUPAC name of 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid (CID 82033149) is 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid.
What is the SMILES notation for 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid?
The canonical SMILES for 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid is CCC(Nc1ncnc2sc(C)cc12)C(=O)NCCCC(=O)O.
What is the InChIKey of 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid?
The InChIKey is MGMKSBZOTOGZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O3S/c1-3-11(14(22)16-6-4-5-12(20)21)19-13-10-7-9(2)23-15(10)18-8-17-13/h7-8,11H,3-6H2,1-2H3,(H,16,22)(H,20,21)(H,17,18,19).
What are the key properties of 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid?
4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid has a molecular weight of 336.42 g/mol, XLogP of 2.17, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoylamino]butanoic acid is sourced from PubChem (CID 82033149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).