C15H20N4O3S — CID 82033181
4-[[4-(dimethylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl]amino]butanoic acid (PubChem CID 82033181) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(dimethylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 82033181 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-[[4-(dimethylamino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl]amino]butanoic acid |
| SMILES | Cc1nc(N(C)C)c2c(C)c(C(=O)NCCCC(=O)O)sc2n1 |
| InChI | InChI=1S/C15H20N4O3S/c1-8-11-13(19(3)4)17-9(2)18-15(11)23-12(8)14(22)16-7-5-6-10(20)21/h5-7H2,1-4H3,(H,16,22)(H,20,21) |
| InChIKey | QJKHDUBYAXDDHP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|