C16H17N3O4S — CID 82033552
3-[[5-ethyl-2-(pyridine-3-carbonylamino)thiophene-3-carbonyl]amino]propanoic acid (PubChem CID 82033552) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-[[5-ethyl-2-(pyridine-3-carbonylamino)thiophene-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-ethyl-2-(pyridine-3-carbonylamino)thiophene-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82033552 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-[[5-ethyl-2-(pyridine-3-carbonylamino)thiophene-3-carbonyl]amino]propanoic acid |
| SMILES | CCc1cc(C(=O)NCCC(=O)O)c(NC(=O)c2cccnc2)s1 |
| InChI | InChI=1S/C16H17N3O4S/c1-2-11-8-12(15(23)18-7-5-13(20)21)16(24-11)19-14(22)10-4-3-6-17-9-10/h3-4,6,8-9H,2,5,7H2,1H3,(H,18,23)(H,19,22)(H,20,21) |
| InChIKey | RTCSDVLUTLYGFL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |