C16H24N4O — CID 82034085
2-amino-N-[5-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-pyridinyl]acetamide (PubChem CID 82034085) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-amino-N-[5-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-pyridinyl]acetamide.
| Compound Name | 2-amino-N-[5-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 82034085 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 2-amino-N-[5-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-pyridinyl]acetamide |
| SMILES | CC(Nc1ccc(NC(=O)CN)nc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H24N4O/c1-10(14-7-11-2-3-12(14)6-11)19-13-4-5-15(18-9-13)20-16(21)8-17/h4-5,9-12,14,19H,2-3,6-8,17H2,1H3,(H,18,20,21) |
| InChIKey | UNFQZMSJQJVGTJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |