C19H23N3O3 — CID 82034547
3-amino-N-[2-ethyl-5-[(2-phenoxyacetyl)amino]phenyl]propanamide (PubChem CID 82034547) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-amino-N-[2-ethyl-5-[(2-phenoxyacetyl)amino]phenyl]propanamide.
| Compound Name | 3-amino-N-[2-ethyl-5-[(2-phenoxyacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 82034547 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-amino-N-[2-ethyl-5-[(2-phenoxyacetyl)amino]phenyl]propanamide |
| SMILES | CCc1ccc(NC(=O)COc2ccccc2)cc1NC(=O)CCN |
| InChI | InChI=1S/C19H23N3O3/c1-2-14-8-9-15(12-17(14)22-18(23)10-11-20)21-19(24)13-25-16-6-4-3-5-7-16/h3-9,12H,2,10-11,13,20H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | WZNCPKJTUQUQQG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |