C12H17N3S — CID 82035160
(2,6-dimethyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methanamine (PubChem CID 82035160) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is (2,6-dimethyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methanamine.
| Compound Name | (2,6-dimethyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methanamine |
|---|---|
| PubChem CID | 82035160 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2,6-dimethyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methanamine |
| SMILES | Cc1nc2sc3c(n2c1CN)CCC(C)C3 |
| InChI | InChI=1S/C12H17N3S/c1-7-3-4-9-11(5-7)16-12-14-8(2)10(6-13)15(9)12/h7H,3-6,13H2,1-2H3 |
| InChIKey | DZPFELZQZUDSOS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |