C17H13F3N2O3S — CID 82035880
6-[4-(2-methylprop-2-enoxy)phenyl]-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid (PubChem CID 82035880) has the molecular formula C17H13F3N2O3S and a molecular weight of 382.36 g/mol. Its IUPAC name is 6-[4-(2-methylprop-2-enoxy)phenyl]-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid.
| Compound Name | 6-[4-(2-methylprop-2-enoxy)phenyl]-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 82035880 |
| Molecular Formula | C17H13F3N2O3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 6-[4-(2-methylprop-2-enoxy)phenyl]-3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| SMILES | C=C(C)COc1ccc(-c2cn3c(C(F)(F)F)c(C(=O)O)sc3n2)cc1 |
| InChI | InChI=1S/C17H13F3N2O3S/c1-9(2)8-25-11-5-3-10(4-6-11)12-7-22-14(17(18,19)20)13(15(23)24)26-16(22)21-12/h3-7H,1,8H2,2H3,(H,23,24) |
| InChIKey | HUYPVTJQFZDRQE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|