About (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol
(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol (PubChem CID 82036391) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol.
Molecular Properties
| Compound Name | (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol |
| PubChem CID | 82036391 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol |
| SMILES | Cc1nn(C)c2nc(Cl)c(CO)cc12 |
| InChI | InChI=1S/C9H10ClN3O/c1-5-7-3-6(4-14)8(10)11-9(7)13(2)12-5/h3,14H,4H2,1-2H3 |
| InChIKey | HMYYWQYUWHMSLV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol?
The IUPAC name of (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol (CID 82036391) is (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol.
What is the SMILES notation for (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol?
The canonical SMILES for (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol is Cc1nn(C)c2nc(Cl)c(CO)cc12.
What is the InChIKey of (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol?
The InChIKey is HMYYWQYUWHMSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c1-5-7-3-6(4-14)8(10)11-9(7)13(2)12-5/h3,14H,4H2,1-2H3.
What are the key properties of (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol?
(6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol has a molecular weight of 211.65 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanol is sourced from PubChem (CID 82036391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).