C11H10BrNO4 — CID 82036897
(Z)-4-(4-bromo-3-methoxyanilino)-4-oxobut-2-enoic acid (PubChem CID 82036897) has the molecular formula C11H10BrNO4 and a molecular weight of 300.11 g/mol. Its IUPAC name is (Z)-4-(4-bromo-3-methoxyanilino)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(4-bromo-3-methoxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 82036897 |
| Molecular Formula | C11H10BrNO4 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | (Z)-4-(4-bromo-3-methoxyanilino)-4-oxobut-2-enoic acid |
| SMILES | COc1cc(NC(=O)/C=C\C(=O)O)ccc1Br |
| InChI | InChI=1S/C11H10BrNO4/c1-17-9-6-7(2-3-8(9)12)13-10(14)4-5-11(15)16/h2-6H,1H3,(H,13,14)(H,15,16)/b5-4- |
| InChIKey | YYLHKMQMASMOAS-PLNGDYQASA-N |
| XLogP | 2.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|