C16H20Cl2N2O2 — CID 82038014
1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(2,4-dichlorophenoxy)propan-1-one (PubChem CID 82038014) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(2,4-dichlorophenoxy)propan-1-one.
| Compound Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(2,4-dichlorophenoxy)propan-1-one |
|---|---|
| PubChem CID | 82038014 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(2,4-dichlorophenoxy)propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-11(22-14-3-2-12(17)8-13(14)18)15(21)20-7-5-16(10-20)4-6-19-9-16/h2-3,8,11,19H,4-7,9-10H2,1H3 |
| InChIKey | NRMCHCLCZMXWGA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |