About 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane
2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 82038202) has the molecular formula C13H18N2O2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 82038202 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | O=S(=O)(c1ccccc1)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C13H18N2O2S/c16-18(17,12-4-2-1-3-5-12)15-9-7-13(11-15)6-8-14-10-13/h1-5,14H,6-11H2 |
| InChIKey | UTHFUHYFUBCEIF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane (CID 82038202) is 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane is O=S(=O)(c1ccccc1)N1CCC2(CCNC2)C1.
What is the InChIKey of 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane?
The InChIKey is UTHFUHYFUBCEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S/c16-18(17,12-4-2-1-3-5-12)15-9-7-13(11-15)6-8-14-10-13/h1-5,14H,6-11H2.
What are the key properties of 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane?
2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane has a molecular weight of 266.37 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 82038202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).