C15H19FN2O — CID 82038211
1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(4-fluorophenyl)ethanone (PubChem CID 82038211) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 82038211 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C15H19FN2O/c16-13-3-1-12(2-4-13)9-14(19)18-8-6-15(11-18)5-7-17-10-15/h1-4,17H,5-11H2 |
| InChIKey | ZJXRRFJYHDOGAZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |