C17H17NO3 — CID 82039271
1-[4-(2-amino-4-methoxyphenyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 82039271) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[4-(2-amino-4-methoxyphenyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-(2-amino-4-methoxyphenyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 82039271 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[4-(2-amino-4-methoxyphenyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | COc1ccc(-c2ccc(C3(C(=O)O)CC3)cc2)c(N)c1 |
| InChI | InChI=1S/C17H17NO3/c1-21-13-6-7-14(15(18)10-13)11-2-4-12(5-3-11)17(8-9-17)16(19)20/h2-7,10H,8-9,18H2,1H3,(H,19,20) |
| InChIKey | STKHTRXLVSPGKR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|