C18H19NO3 — CID 82039411
2-[4-(1-methyl-2,3-dihydroindol-5-yl)phenoxy]propanoic acid (PubChem CID 82039411) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[4-(1-methyl-2,3-dihydroindol-5-yl)phenoxy]propanoic acid.
| Compound Name | 2-[4-(1-methyl-2,3-dihydroindol-5-yl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 82039411 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[4-(1-methyl-2,3-dihydroindol-5-yl)phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(-c2ccc3c(c2)CCN3C)cc1)C(=O)O |
| InChI | InChI=1S/C18H19NO3/c1-12(18(20)21)22-16-6-3-13(4-7-16)14-5-8-17-15(11-14)9-10-19(17)2/h3-8,11-12H,9-10H2,1-2H3,(H,20,21) |
| InChIKey | KVGLYSYYKBGMHI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |