C13H18N2O — CID 82040812
4-(2-methyl-2,3-dihydroindol-1-yl)butanamide (PubChem CID 82040812) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydroindol-1-yl)butanamide.
| Compound Name | 4-(2-methyl-2,3-dihydroindol-1-yl)butanamide |
|---|---|
| PubChem CID | 82040812 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-(2-methyl-2,3-dihydroindol-1-yl)butanamide |
| SMILES | CC1Cc2ccccc2N1CCCC(N)=O |
| InChI | InChI=1S/C13H18N2O/c1-10-9-11-5-2-3-6-12(11)15(10)8-4-7-13(14)16/h2-3,5-6,10H,4,7-9H2,1H3,(H2,14,16) |
| InChIKey | JXOSVKSQJZOLPO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |