2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride

C11H19ClN2O2 — CID 82041829

IUPAC2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride
SMILESCC(C)C(C(=O)Cl)N1CCC(C(N)=O)CC1
InChIInChI=1S/C11H19ClN2O2/c1-7(2)9(10(12)15)14-5-3-8(4-6-14)11(13)16/h7-9H,3-6H2,1-2H3,(H2,13,16)
InChIKeyKYUMOIWJEMTYMH-UHFFFAOYSA-N
MW246.74 g/mol
LogP0.97
Rot. Bonds4

About 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride

2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride (PubChem CID 82041829) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride.

Molecular Properties

Compound Name2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride
PubChem CID82041829
Molecular FormulaC11H19ClN2O2
Molecular Weight246.74 g/mol
Exact Mass246.11
IUPAC Name2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride
SMILESCC(C)C(C(=O)Cl)N1CCC(C(N)=O)CC1
InChIInChI=1S/C11H19ClN2O2/c1-7(2)9(10(12)15)14-5-3-8(4-6-14)11(13)16/h7-9H,3-6H2,1-2H3,(H2,13,16)
InChIKeyKYUMOIWJEMTYMH-UHFFFAOYSA-N
XLogP0.97
TPSA63.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.74
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride?
The IUPAC name of 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride (CID 82041829) is 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride.
What is the SMILES notation for 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride?
The canonical SMILES for 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride is CC(C)C(C(=O)Cl)N1CCC(C(N)=O)CC1.
What is the InChIKey of 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride?
The InChIKey is KYUMOIWJEMTYMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClN2O2/c1-7(2)9(10(12)15)14-5-3-8(4-6-14)11(13)16/h7-9H,3-6H2,1-2H3,(H2,13,16).
What are the key properties of 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride?
2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride has a molecular weight of 246.74 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-carbamoylpiperidin-1-yl)-3-methylbutanoyl chloride is sourced from PubChem (CID 82041829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).