C12H24N2O4 — CID 82042455
2-[[2-[ethyl(2-hydroxyethyl)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 82042455) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[[2-[ethyl(2-hydroxyethyl)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[ethyl(2-hydroxyethyl)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82042455 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-[[2-[ethyl(2-hydroxyethyl)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CCN(CCO)CC(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H24N2O4/c1-4-14(5-6-15)8-11(16)13-10(12(17)18)7-9(2)3/h9-10,15H,4-8H2,1-3H3,(H,13,16)(H,17,18) |
| InChIKey | UYJDPJOOHDSYIG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |