About (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine
(Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine (PubChem CID 82043537) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine |
| PubChem CID | 82043537 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine |
| SMILES | NCC(/C=C\c1ccccc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H22N2/c20-14-19(11-10-16-6-2-1-3-7-16)21-13-12-17-8-4-5-9-18(17)15-21/h1-11,19H,12-15,20H2/b11-10- |
| InChIKey | FIOZYKBNGKZUOI-KHPPLWFESA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine?
The IUPAC name of (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine (CID 82043537) is (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine.
What is the SMILES notation for (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine?
The canonical SMILES for (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine is NCC(/C=C\c1ccccc1)N1CCc2ccccc2C1.
What is the InChIKey of (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine?
The InChIKey is FIOZYKBNGKZUOI-KHPPLWFESA-N. The full InChI is InChI=1S/C19H22N2/c20-14-19(11-10-16-6-2-1-3-7-16)21-13-12-17-8-4-5-9-18(17)15-21/h1-11,19H,12-15,20H2/b11-10-.
What are the key properties of (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine?
(Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine has a molecular weight of 278.40 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-phenylbut-3-en-1-amine is sourced from PubChem (CID 82043537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).