C12H15NO3 — CID 82045927
spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4,5-diol (PubChem CID 82045927) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4,5-diol.
| Compound Name | spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4,5-diol |
|---|---|
| PubChem CID | 82045927 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | spiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4,5-diol |
| SMILES | Oc1cccc2c1C(O)CC1(CCNC1)O2 |
| InChI | InChI=1S/C12H15NO3/c14-8-2-1-3-10-11(8)9(15)6-12(16-10)4-5-13-7-12/h1-3,9,13-15H,4-7H2 |
| InChIKey | BWEODOFCUMFELX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |