C17H17NO4 — CID 82046281
7-amino-2-(2,3-dimethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 82046281) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 7-amino-2-(2,3-dimethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 7-amino-2-(2,3-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 82046281 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 7-amino-2-(2,3-dimethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cccc(C2CC(=O)c3ccc(N)cc3O2)c1OC |
| InChI | InChI=1S/C17H17NO4/c1-20-14-5-3-4-12(17(14)21-2)16-9-13(19)11-7-6-10(18)8-15(11)22-16/h3-8,16H,9,18H2,1-2H3 |
| InChIKey | JSYLTDZKLWIKJK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|