About 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one
8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 82046362) has the molecular formula C14H16FNO2
and a molecular weight of 249.28 g/mol. Its IUPAC name is 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one |
| PubChem CID | 82046362 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | Nc1cc(F)cc2c1OC1(CCCCC1)CC2=O |
| InChI | InChI=1S/C14H16FNO2/c15-9-6-10-12(17)8-14(4-2-1-3-5-14)18-13(10)11(16)7-9/h6-7H,1-5,8,16H2 |
| InChIKey | KXQMHALIKWZLET-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one?
The IUPAC name of 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one (CID 82046362) is 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one?
The canonical SMILES for 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one is Nc1cc(F)cc2c1OC1(CCCCC1)CC2=O.
What is the InChIKey of 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one?
The InChIKey is KXQMHALIKWZLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FNO2/c15-9-6-10-12(17)8-14(4-2-1-3-5-14)18-13(10)11(16)7-9/h6-7H,1-5,8,16H2.
What are the key properties of 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one?
8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one has a molecular weight of 249.28 g/mol, XLogP of 3.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-fluorospiro[3H-chromene-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 82046362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).