About 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one
8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 82046364) has the molecular formula C14H17FN2O2
and a molecular weight of 264.30 g/mol. Its IUPAC name is 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
Molecular Properties
| Compound Name | 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| PubChem CID | 82046364 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CN1CCC2(CC1)CC(=O)c1cc(F)cc(N)c1O2 |
| InChI | InChI=1S/C14H17FN2O2/c1-17-4-2-14(3-5-17)8-12(18)10-6-9(15)7-11(16)13(10)19-14/h6-7H,2-5,8,16H2,1H3 |
| InChIKey | BVGUKJPGYGHQDO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one?
The IUPAC name of 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one (CID 82046364) is 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
What is the SMILES notation for 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one?
The canonical SMILES for 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one is CN1CCC2(CC1)CC(=O)c1cc(F)cc(N)c1O2.
What is the InChIKey of 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one?
The InChIKey is BVGUKJPGYGHQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O2/c1-17-4-2-14(3-5-17)8-12(18)10-6-9(15)7-11(16)13(10)19-14/h6-7H,2-5,8,16H2,1H3.
What are the key properties of 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one?
8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one has a molecular weight of 264.30 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-fluoro-1'-methylspiro[3H-chromene-2,4'-piperidine]-4-one is sourced from PubChem (CID 82046364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).