C16H22N2O2 — CID 82046423
6-amino-1',7,8-trimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 82046423) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-amino-1',7,8-trimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-amino-1',7,8-trimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 82046423 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 6-amino-1',7,8-trimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1c(N)cc2c(c1C)OC1(CCN(C)CC1)CC2=O |
| InChI | InChI=1S/C16H22N2O2/c1-10-11(2)15-12(8-13(10)17)14(19)9-16(20-15)4-6-18(3)7-5-16/h8H,4-7,9,17H2,1-3H3 |
| InChIKey | CFWPPOAFJGPISE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|