About 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one
6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one (PubChem CID 82046503) has the molecular formula C16H11NO4
and a molecular weight of 281.27 g/mol. Its IUPAC name is 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one.
Molecular Properties
| Compound Name | 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
| PubChem CID | 82046503 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
| SMILES | Nc1ccc(-c2cc(=O)c3cc4c(cc3o2)OCO4)cc1 |
| InChI | InChI=1S/C16H11NO4/c17-10-3-1-9(2-4-10)13-6-12(18)11-5-15-16(20-8-19-15)7-14(11)21-13/h1-7H,8,17H2 |
| InChIKey | YVQRHOLIOFCDJV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one?
The IUPAC name of 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one (CID 82046503) is 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one.
What is the SMILES notation for 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one?
The canonical SMILES for 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one is Nc1ccc(-c2cc(=O)c3cc4c(cc3o2)OCO4)cc1.
What is the InChIKey of 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one?
The InChIKey is YVQRHOLIOFCDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO4/c17-10-3-1-9(2-4-10)13-6-12(18)11-5-15-16(20-8-19-15)7-14(11)21-13/h1-7H,8,17H2.
What are the key properties of 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one?
6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one has a molecular weight of 281.27 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-aminophenyl)-[1,3]dioxolo[4,5-g]chromen-8-one is sourced from PubChem (CID 82046503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).