About 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine
2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine (PubChem CID 82046760) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine.
Molecular Properties
| Compound Name | 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine |
| PubChem CID | 82046760 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine |
| SMILES | NCCN1CCC2(C=Cc3ccccc3O2)CC1 |
| InChI | InChI=1S/C15H20N2O/c16-9-12-17-10-7-15(8-11-17)6-5-13-3-1-2-4-14(13)18-15/h1-6H,7-12,16H2 |
| InChIKey | YTBSFBXQIKRMEI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine?
The IUPAC name of 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine (CID 82046760) is 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine.
What is the SMILES notation for 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine?
The canonical SMILES for 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine is NCCN1CCC2(C=Cc3ccccc3O2)CC1.
What is the InChIKey of 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine?
The InChIKey is YTBSFBXQIKRMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c16-9-12-17-10-7-15(8-11-17)6-5-13-3-1-2-4-14(13)18-15/h1-6H,7-12,16H2.
What are the key properties of 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine?
2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine has a molecular weight of 244.34 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[chromene-2,4'-piperidine]-1'-ylethanamine is sourced from PubChem (CID 82046760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).